AD33626
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $19.00 | $14.00 | - + | |
250mg | 97% | in stock | $31.00 | $22.00 | - + | |
1g | 97% | in stock | $69.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD33626 |
Chemical Name: | 2-Amino-5,6-dichlorobenzimidazole |
CAS Number: | 18672-03-2 |
Molecular Formula: | C7H5Cl2N3 |
Molecular Weight: | 202.0407 |
MDL Number: | MFCD08234602 |
SMILES: | Nc1[nH]c2c(n1)cc(c(c2)Cl)Cl |
Complexity: | 178 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 2.5 |
Bioorganic & medicinal chemistry 20070115
Bioorganic & medicinal chemistry letters 20020819
Journal of medicinal chemistry 19950929