AD62882
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $17.00 | $12.00 | - + | |
10g | 98% | in stock | $33.00 | $24.00 | - + | |
25g | 98% | in stock | $42.00 | $30.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD62882 |
Chemical Name: | 8-Quinolinesulfonyl chloride |
CAS Number: | 18704-37-5 |
Molecular Formula: | C9H6ClNO2S |
Molecular Weight: | 227.66743999999997 |
MDL Number: | MFCD00006808 |
SMILES: | ClS(=O)(=O)c1cccc2c1nccc2 |
NSC Number: | 91506 |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
European journal of medicinal chemistry 20040701