AB15184
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $27.00 | $19.00 | - + | |
5mg | ≥95% | in stock | $61.00 | $43.00 | - + | |
10mg | ≥95% | in stock | $94.00 | $66.00 | - + | |
25mg | ≥95% | in stock | $206.00 | $144.00 | - + | |
50mg | 98% | in stock | $218.00 | $153.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB15184 |
Chemical Name: | Gsk3787 |
CAS Number: | 188591-46-0 |
Molecular Formula: | C15H12ClF3N2O3S |
Molecular Weight: | 392.7806 |
MDL Number: | MFCD00099612 |
SMILES: | Clc1ccc(cc1)C(=O)NCCS(=O)(=O)c1ccc(cn1)C(F)(F)F |
Complexity: | 557 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.9 |
Bioorganic & medicinal chemistry letters 20130801
PloS one 20120101
Molecular pharmacology 20100901
Journal of medicinal chemistry 20100225