logo
Home  > Fluorescein 6-isothiocyanate

AB74249

18861-78-4 | Fluorescein 6-isothiocyanate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $179.00 $125.00 -   +
250mg 95% in stock $226.00 $158.00 -   +
1g 95% in stock $512.00 $358.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB74249
Chemical Name: Fluorescein 6-isothiocyanate
CAS Number: 18861-78-4
Molecular Formula: C21H11NO5S
Molecular Weight: 389.3807
MDL Number: MFCD00041838
SMILES: S=C=Nc1ccc2c(c1)C1(OC2=O)c2ccc(cc2Oc2c1ccc(c2)O)O

 

Upstream Synthesis Route
  • 6-FITC, also known as 6-carboxyfluorescein, is a highly versatile and widely used fluorescent dye in chemical synthesis. It is particularly valued for its ability to selectively label and track specific molecules and structures within complex chemical systems.In chemical synthesis, 6-FITC is commonly employed as a molecular probe to visualize and monitor the progress of reactions in real-time. Its bright fluorescence and stability make it an ideal choice for tracking the formation and transformation of chemical compounds. Researchers often attach 6-FITC to target molecules or functional groups of interest, allowing them to observe the movement and interactions of these entities throughout a reaction pathway.Additionally, 6-FITC can serve as a valuable tool for studying molecular dynamics and kinetics in various chemical processes. By incorporating 6-FITC into reaction substrates or products, chemists can gain insights into reaction mechanisms, intermediates, and product distributions. This information is crucial for optimizing reaction conditions, improving yields, and designing more efficient synthetic routes.Overall, the unique properties of 6-FITC make it an indispensable reagent for chemists seeking to unravel the complexities of chemical synthesis and enhance their understanding of reaction mechanisms and dynamics.
FEATURED PRODUCTS