AB16783
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $6.00 | $5.00 | - + | |
5g | 95% | in stock | $15.00 | $10.00 | - + | |
10g | 95% | in stock | $21.00 | $15.00 | - + | |
25g | 95% | in stock | $36.00 | $25.00 | - + | |
50g | 95% | in stock | $70.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB16783 |
Chemical Name: | 4-Boc-2-morpholinecarboxylic acid |
CAS Number: | 189321-66-2 |
Molecular Formula: | C10H17NO5 |
Molecular Weight: | 231.2457 |
MDL Number: | MFCD01321006 |
SMILES: | OC(=O)C1OCCN(C1)C(=O)OC(C)(C)C |
Complexity: | 283 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 0.4 |
The Journal of organic chemistry 20080502