AB16783
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 97% | in stock | $3.00 | $2.00 | - + | |
5g | 97% | in stock | $18.00 | $12.00 | - + | |
10g | 97% | in stock | $22.00 | $15.00 | - + | |
15g | 97% | in stock | $25.00 | $17.00 | - + | |
25g | 97% | in stock | $35.00 | $24.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB16783 |
Chemical Name: | 2,4-Morpholinedicarboxylic acid, 4-(1,1-dimethylethyl) ester |
CAS Number: | 189321-66-2 |
Molecular Formula: | C10H17NO5 |
Molecular Weight: | 231.2457 |
MDL Number: | MFCD01321006 |
SMILES: | OC(=O)C1OCCN(C1)C(=O)OC(C)(C)C |
Complexity: | 283 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 0.4 |
The Journal of organic chemistry 20080502