AB12702
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $45.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB12702 |
Chemical Name: | 5-Chloroindole-3-acetic acid |
CAS Number: | 1912-45-4 |
Molecular Formula: | C10H8ClNO2 |
Molecular Weight: | 209.6290 |
MDL Number: | MFCD00130159 |
SMILES: | OC(=O)Cc1c[nH]c2c1cc(Cl)cc2 |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
Bioinorganic chemistry and applications 20110101
Bioorganic & medicinal chemistry 20070701
Bioorganic & medicinal chemistry letters 20020916