AB13079
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $89.00 | $62.00 | - + | |
1g | 95% | in stock | $185.00 | $130.00 | - + | |
5g | 95% | in stock | $471.00 | $330.00 | - + | |
10g | 95% | in stock | $803.00 | $562.00 | - + | |
25g | 95% | in stock | $1,480.00 | $1,036.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB13079 |
Chemical Name: | 6-Bromo-2-methyl-4h-3,1-benzoxazin-4-one |
CAS Number: | 19165-25-4 |
Molecular Formula: | C9H6BrNO2 |
Molecular Weight: | 240.0534 |
MDL Number: | MFCD00115891 |
SMILES: | Brc1ccc2c(c1)c(=O)oc(n2)C |
Complexity: | 264 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 2 |
Indian journal of pharmaceutical sciences 20110101