AB77199
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $6.00 | - + | |
10g | 98% | in stock | $15.00 | $11.00 | - + | |
25g | 98% | in stock | $32.00 | $23.00 | - + | |
100g | 98% | in stock | $100.00 | $70.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77199 |
Chemical Name: | Z-6-aminohexanoic acid |
CAS Number: | 1947-00-8 |
Molecular Formula: | C14H19NO4 |
Molecular Weight: | 265.305 |
MDL Number: | MFCD00004423 |
SMILES: | OC(=O)CCCCCNC(=O)OCc1ccccc1 |
NSC Number: | 92812 |
Complexity: | 275 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 2 |
Journal of medicinal chemistry 20090514
Bioconjugate chemistry 20050101