AD32197
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $50.00 | $35.00 | - + | |
250mg | 97% | in stock | $80.00 | $56.00 | - + | |
1g | 97% | in stock | $137.00 | $96.00 | - + | |
5g | 97% | in stock | $347.00 | $243.00 | - + | |
10g | 97% | in stock | $541.00 | $379.00 | - + | |
25g | 97% | in stock | $1,069.00 | $748.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD32197 |
Chemical Name: | 6-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
CAS Number: | 19492-02-5 |
Molecular Formula: | C10H7ClO3 |
Molecular Weight: | 210.6138 |
MDL Number: | MFCD00816527 |
SMILES: | O=c1cc(C)c2c(o1)cc(c(c2)Cl)O |
Complexity: | 287 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.5 |
Bioorganic & medicinal chemistry 20120915
Journal of applied microbiology 20061101