AB55643
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $73.00 | $51.00 | - + | |
100mg | 95% | in stock | $129.00 | $91.00 | - + | |
250mg | 95% | in stock | $210.00 | $147.00 | - + | |
1g | 95% | in stock | $353.00 | $247.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55643 |
Chemical Name: | (R)-2-Amino-n-benzyl-3-methoxypropanamide |
CAS Number: | 196601-69-1 |
Molecular Formula: | C11H16N2O2 |
Molecular Weight: | 208.2569 |
MDL Number: | MFCD14708219 |
SMILES: | COC[C@H](C(=O)NCc1ccccc1)N |
Complexity: | 191 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
Journal of medicinal chemistry 20110714