AD30761
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 97%(HPLC) | in stock | $53.00 | $37.00 | - + | |
25mg | 97%(HPLC) | in stock | $137.00 | $96.00 | - + | |
100mg | 97%(HPLC) | in stock | $288.00 | $202.00 | - + | |
1g | 90.0% | in stock | $579.00 | $406.00 | - + | |
5g | 90.0% | in stock | $1,587.00 | $1,111.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD30761 |
Chemical Name: | 4-[N-(2,4-Diamino-6-pteridinylmethyl)-n-methylamino]benzoic acid |
CAS Number: | 19741-14-1 |
Molecular Formula: | C15H15N7O2 |
Molecular Weight: | 325.3253 |
MDL Number: | MFCD00075774 |
SMILES: | Nc1nc(N)c2c(n1)ncc(n2)CN(c1ccc(cc1)C(=O)O)C |
NSC Number: | 131463 |
Complexity: | 444 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | -1.1 |
Biomedical chromatography : BMC 20120101
Clinical laboratory 20110101
Clinical chemistry 20101201
Clinical chemistry 20101201
Electrophoresis 20040801
Antimicrobial agents and chemotherapy 19930901
Antimicrobial agents and chemotherapy 19910701
The Journal of protozoology 19910101