AB07549
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $114.00 | $80.00 | - + | |
250mg | 97% | in stock | $171.00 | $120.00 | - + | |
1g | 97% | in stock | $403.00 | $282.00 | - + | |
5g | 97% | in stock | $1,179.00 | $825.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB07549 |
Chemical Name: | H-Pro-Tyr-OH |
CAS Number: | 19786-36-8 |
Molecular Formula: | C14H18N2O4 |
Molecular Weight: | 278.3037 |
MDL Number: | MFCD00037870 |
SMILES: | OC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@@H]1CCCN1 |
Complexity: | 353 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | -2.4 |
The journal of physical chemistry. A 20070426