AB08360
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $38.00 | $26.00 | - + | |
1g | 95% | in stock | $54.00 | $38.00 | - + | |
5g | 95% | in stock | $89.00 | $63.00 | - + | |
10g | 95% | in stock | $176.00 | $124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB08360 |
Chemical Name: | L-2-Nitrophenylalanine |
CAS Number: | 19883-75-1 |
Molecular Formula: | C9H10N2O4 |
Molecular Weight: | 210.1867 |
MDL Number: | MFCD00270360 |
SMILES: | OC(=O)[C@H](Cc1ccccc1[N+](=O)[O-])N |
Complexity: | 251 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.6 |
The Journal of organic chemistry 20110506
Journal of the American Chemical Society 20100324
Chemistry & biology 20090227