AB08685
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $19.00 | $14.00 | - + | |
250mg | 97% | in stock | $30.00 | $21.00 | - + | |
1g | 97% | in stock | $50.00 | $35.00 | - + | |
5g | 97% | in stock | $211.00 | $148.00 | - + | |
10g | 97% | in stock | $315.00 | $221.00 | - + | |
25g | 97% | in stock | $605.00 | $423.00 | - + | |
100g | 97% | in stock | $1,941.00 | $1,359.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB08685 |
Chemical Name: | tert-Butyl (5-formylpyridin-2-yl)carbamate |
CAS Number: | 199296-40-7 |
Molecular Formula: | C11H14N2O3 |
Molecular Weight: | 222.2405 |
MDL Number: | MFCD08064228 |
SMILES: | O=Cc1ccc(nc1)NC(=O)OC(C)(C)C |
Complexity: | 260 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.2 |
The tert-Butyl (5-formylpyridin-2-yl)carbamate is a versatile intermediate used in chemical synthesis for the development of various organic compounds. Due to its unique structure and reactivity, this compound serves as a key building block in the creation of complex molecules. Its application in chemical synthesis includes serving as a protected formyl group donor, facilitating selective modifications in organic synthesis. Furthermore, the tert-Butyl (5-formylpyridin-2-yl)carbamate can participate in diverse reactions such as condensation, reduction, and cross-coupling, enabling the synthesis of a wide range of functionalized compounds with tailored properties. Its strategic placement within a molecule can also impact the overall reactivity and stability of the final product, making it a valuable tool for synthetic chemists aiming to design novel chemical entities for various applications.