AB09255
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $17.00 | $12.00 | - + | |
25g | 98% | in stock | $71.00 | $50.00 | - + | |
100g | 95% | in stock | $277.00 | $194.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB09255 |
Chemical Name: | Chelidamic acid hydrate |
CAS Number: | 199926-39-1 |
Molecular Formula: | C7H7NO6 |
Molecular Weight: | 201.1336 |
MDL Number: | MFCD03818117 |
SMILES: | OC(=O)c1[nH]c(cc(=O)c1)C(=O)O.O |
Complexity: | 320 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
4-Oxo-1,4-dihydropyridine-2,6-dicarboxylic acid hydrate, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure makes it a valuable building block in the preparation of various organic compounds. In chemical synthesis, $name$ serves as a key intermediate for the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. It is particularly important in the synthesis of heterocyclic compounds and can be utilized in the formation of diverse molecular structures. Additionally, $name$ can undergo various reactions such as condensation, reduction, and oxidation, enabling its incorporation into complex molecules with diverse functionalities. Its role in chemical synthesis extends to the production of research chemicals and materials utilized in various industries. Overall, the application of 4-Oxo-1,4-dihydropyridine-2,6-dicarboxylic acid hydrate in chemical synthesis is crucial for the development of novel compounds with potential applications in pharmaceuticals, agriculture, and materials science.