AB04575
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $18.00 | $12.00 | - + | |
5g | 97% | in stock | $22.00 | $15.00 | - + | |
10g | 97% | in stock | $28.00 | $19.00 | - + | |
25g | 97% | in stock | $35.00 | $24.00 | - + | |
100g | 97% | in stock | $131.00 | $92.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB04575 |
Chemical Name: | 1-Butylpyridinium tetrafluoroborate |
CAS Number: | 203389-28-0 |
Molecular Formula: | C9H14BF4N |
Molecular Weight: | 223.0188 |
MDL Number: | MFCD03427602 |
SMILES: | F[B-](F)(F)F.CCCC[n+]1ccccc1 |
Complexity: | 93.9 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 3 |
The journal of physical chemistry. B 20100708
Chemical communications (Cambridge, England) 20060621