AB18358
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $25.00 | $17.00 | - + | |
10g | 95% | in stock | $33.00 | $23.00 | - + | |
25g | 95% | in stock | $46.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB18358 |
Chemical Name: | Z-Ser(Bzl)-OH |
CAS Number: | 20806-43-3 |
Molecular Formula: | C18H19NO5 |
Molecular Weight: | 329.3472 |
MDL Number: | MFCD00022029 |
SMILES: | O=C(N[C@H](C(=O)O)COCc1ccccc1)OCc1ccccc1 |
Complexity: | 389 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 2.4 |
European journal of medicinal chemistry 20070301