AB18509
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $8.00 | $6.00 | - + | |
5mg | 98% | in stock | $21.00 | $15.00 | - + | |
10mg | 98% | in stock | $36.00 | $25.00 | - + | |
25mg | 98% | in stock | $73.00 | $51.00 | - + | |
100mg | 98% | in stock | $165.00 | $115.00 | - + | |
250mg | 98% | in stock | $366.00 | $256.00 | - + | |
1g | 98% | in stock | $696.00 | $487.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB18509 |
Chemical Name: | Dapt |
CAS Number: | 208255-80-5 |
Molecular Formula: | C23H26F2N2O4 |
Molecular Weight: | 432.4603 |
MDL Number: | MFCD04974585 |
SMILES: | O=C(N[C@H](C(=O)NC(c1ccccc1)C(=O)OC(C)(C)C)C)Cc1cc(F)cc(c1)F |
Complexity: | 622 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 3.7 |
Bioorganic & medicinal chemistry letters 20110501
Bioorganic & medicinal chemistry letters 20091215
Journal of medicinal chemistry 20081211
The Journal of biological chemistry 20071221
The Journal of biological chemistry 20070824