AB18821
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $6.00 | $5.00 | - + | |
5g | 98% | in stock | $20.00 | $14.00 | - + | |
10g | 98% | in stock | $21.00 | $15.00 | - + | |
25g | 98% | in stock | $52.00 | $37.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB18821 |
Chemical Name: | Boc-His(Boc)-OH |
CAS Number: | 20866-46-0 |
Molecular Formula: | C16H25N3O6 |
Molecular Weight: | 355.3862 |
MDL Number: | MFCD00065577 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)Cc1ncn(c1)C(=O)OC(C)(C)C |
Boc-His(Boc)-OH, also known as N-alpha-Boc-L-histidine, is a valuable building block in chemical synthesis due to its versatile functional groups and unique properties. This compound is widely used as a protected form of L-histidine, an essential amino acid with various biological activities. In chemical synthesis, Boc-His(Boc)-OH serves as a key intermediate for the preparation of peptide and protein derivatives. The Boc (tert-butyloxycarbonyl) protecting group on the amino group of histidine provides stability during synthesis, allowing for selective deprotection and further modification of the molecule. This enables precise control over the chemical reactions and ensures the desired outcomes in the synthesis of complex peptides and proteins.Additionally, Boc-His(Boc)-OH can be utilized in the construction of peptide libraries, pharmaceutical research, and drug development. Its compatibility with solid-phase peptide synthesis techniques makes it a valuable tool for creating customized peptides with specific functions and properties. The presence of histidine in the molecule also imparts unique reactivity, which can be exploited for the design of bioactive compounds and peptide-based therapeutics.Overall, Boc-His(Boc)-OH plays a crucial role in the field of chemical synthesis by offering a versatile and reliable platform for the creation of complex peptides and proteins with tailored structures and functions. Its applications extend to various areas of research and development, making it a valuable component in the toolbox of synthetic chemists and pharmaceutical scientists.