AB18952
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $52.00 | $36.00 | - + | |
10g | 95% | in stock | $103.00 | $72.00 | - + | |
25g | 95% | in stock | $245.00 | $171.00 | - + | |
100g | 95% | in stock | $915.00 | $641.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB18952 |
Chemical Name: | Boc-L-cysteine |
CAS Number: | 20887-95-0 |
Molecular Formula: | C8H15NO4S |
Molecular Weight: | 221.274 |
MDL Number: | MFCD00065565 |
SMILES: | SC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 224 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 0.8 |
N-(tert-Butyloxycarbonyl)-L-cysteine, also known as Boc-L-cysteine, is a key intermediate used in chemical synthesis processes. This compound serves as a versatile building block in the production of peptide-based molecules, which are crucial in various fields such as pharmaceuticals, biotechnology, and materials science.By incorporating N-(tert-Butyloxycarbonyl)-L-cysteine into peptide synthesis, chemists can introduce specific functional groups and modify the structure of peptides to enhance their biological activity or stability. Additionally, the Boc protecting group in this compound provides selective reactivity, allowing for controlled manipulation of the peptide chain during synthesis.Overall, N-(tert-Butyloxycarbonyl)-L-cysteine plays a vital role in the creation of complex peptides with tailored properties, making it an indispensable tool in chemical synthesis for the development of novel compounds with diverse applications.
Journal of controlled release : official journal of the Controlled Release Society 20111130
Journal of neuroinflammation 20110101
Arthritis research & therapy 20100101
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20061205
Bioorganic & medicinal chemistry 20030417
Journal of chromatography. B, Biomedical sciences and applications 20010605