AB20024
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $23.00 | $16.00 | - + | |
1g | 95% | in stock | $63.00 | $45.00 | - + | |
5g | 95% | in stock | $154.00 | $108.00 | - + | |
10g | 95% | in stock | $254.00 | $178.00 | - + | |
25g | 95% | in stock | $492.00 | $345.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB20024 |
Chemical Name: | 4-(4-Nitrophenyl)-1,3-thiazol-2-amine |
CAS Number: | 2104-09-8 |
Molecular Formula: | C9H7N3O2S |
Molecular Weight: | 221.23577999999998 |
MDL Number: | MFCD00170222 |
SMILES: | Nc1scc(n1)c1ccc(cc1)[N+](=O)[O-] |
Complexity: | 238 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.4 |
Indian journal of pharmaceutical sciences 20090101