AB20327
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $187.00 | $131.00 | - + | |
5g | 97% | in stock | $721.00 | $505.00 | - + | |
25g | 97% | in stock | $2,625.00 | $1,837.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB20327 |
Chemical Name: | 2-Bromo-1-(4-morpholinophenyl)ethanone |
CAS Number: | 210832-85-2 |
Molecular Formula: | C12H14BrNO2 |
Molecular Weight: | 284.1491 |
MDL Number: | MFCD03783555 |
SMILES: | BrCC(=O)c1ccc(cc1)N1CCOCC1 |
Complexity: | 233 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 20110623