AB69297
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $20.00 | $14.00 | - + | |
250mg | 98% | in stock | $24.00 | $17.00 | - + | |
1g | 98% | in stock | $33.00 | $24.00 | - + | |
5g | 98% | in stock | $122.00 | $86.00 | - + | |
10g | 98% | in stock | $244.00 | $171.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69297 |
Chemical Name: | 5-Hydroxyindole-2-carboxylic acid |
CAS Number: | 21598-06-1 |
Molecular Formula: | C9H7NO3 |
Molecular Weight: | 177.1568 |
MDL Number: | MFCD00005615 |
SMILES: | Oc1ccc2c(c1)cc([nH]2)C(=O)O |
NSC Number: | 117338 |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 2 |
PloS one 20110101
Analytical chemistry 20091101
Journal of medicinal chemistry 20090709
PloS one 20090101
Analytica chimica acta 20080225
Journal of chemical ecology 20040801