AF36909
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $203.00 | $142.00 | - + | |
5g | 98% | in stock | $573.00 | $402.00 | - + | |
25g | 98% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF36909 |
Chemical Name: | 1-Benzyl-1,2,3-benzotriazole-5-carboxylic acid |
CAS Number: | 220143-28-2 |
Molecular Formula: | C14H11N3O2 |
Molecular Weight: | 253.256 |
MDL Number: | MFCD09031749 |
SMILES: | OC(=O)c1ccc2c(c1)nnn2Cc1ccccc1 |
Complexity: | 331 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20060223