AB64336
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $90.00 | $63.00 | - + | |
1g | 95% | in stock | $245.00 | $171.00 | - + | |
5g | 95% | in stock | $921.00 | $645.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB64336 |
Chemical Name: | 3-Benzoylphenylacetic acid |
CAS Number: | 22071-22-3 |
Molecular Formula: | C15H12O3 |
Molecular Weight: | 240.25397999999998 |
MDL Number: | MFCD00046549 |
SMILES: | OC(=O)Cc1cccc(c1)C(=O)c1ccccc1 |
Complexity: | 305 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3 |
The AAPS journal 20080601