AD59587
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $201.00 | $141.00 | - + | |
5g | 97% | in stock | $572.00 | $400.00 | - + | |
10g | 97% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD59587 |
Chemical Name: | 4-(3,5-Difluorophenyl)benzaldehyde |
CAS Number: | 221018-03-7 |
Molecular Formula: | C13H8F2O |
Molecular Weight: | 218.19882640000003 |
MDL Number: | MFCD06858703 |
SMILES: | O=Cc1ccc(cc1)c1cc(F)cc(c1)F |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.2 |
Journal of medicinal chemistry 20040115