AF28373
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $18.00 | $12.00 | - + | |
1g | 97% | in stock | $30.00 | $21.00 | - + | |
5g | 97% | in stock | $92.00 | $64.00 | - + | |
25g | 97% | in stock | $319.00 | $223.00 | - + | |
100g | 97% | in stock | $1,008.00 | $706.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF28373 |
Chemical Name: | N,N-Diethyl-4-nitroaniline |
CAS Number: | 2216-15-1 |
Molecular Formula: | C10H14N2O2 |
Molecular Weight: | 194.2304 |
MDL Number: | MFCD00043606 |
SMILES: | CCN(c1ccc(cc1)[N+](=O)[O-])CC |
Complexity: | 179 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Physical chemistry chemical physics : PCCP 20111006
The journal of physical chemistry. B 20100624
Chemistry (Weinheim an der Bergstrasse, Germany) 20090810
The journal of physical chemistry. B 20090312
The journal of physical chemistry. B 20080731
The journal of physical chemistry. B 20080626
The journal of physical chemistry. B 20060525