AF64142
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $147.00 | $103.00 | - + | |
250mg | 95% | 2 weeks | $235.00 | $164.00 | - + | |
500mg | 95% | 2 weeks | $372.00 | $260.00 | - + | |
1g | 95% | 2 weeks | $509.00 | $357.00 | - + | |
5g | 95% | 2 weeks | $1,388.00 | $972.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF64142 |
Chemical Name: | BUTANOIC ACID, 3-OXO-, 2-[(1,3-DIOXOBUTOXY)METHYL]-2-ETHYL-1,3-PROPANDIYL ESTER |
CAS Number: | 22208-25-9 |
Molecular Formula: | C18H26O9 |
Molecular Weight: | 386.3936 |
MDL Number: | MFCD01697991 |
SMILES: | CCC(COC(=O)CC(=O)C)(COC(=O)CC(=O)C)COC(=O)CC(=O)C |
2-Ethyl-2-(((3-oxobutanoyl)oxy)methyl)propane-1,3-diyl bis(3-oxobutanoate) is a versatile compound that finds significant utility in chemical synthesis processes. Its unique structure and reactivity make it a valuable building block for the creation of complex molecules and polymers. In chemical synthesis, this compound serves as a bifunctional reagent, enabling the formation of ester linkages through its multiple ester groups.One of the key applications of 2-Ethyl-2-(((3-oxobutanoyl)oxy)methyl)propane-1,3-diyl bis(3-oxobutanoate) in chemical synthesis is its use as a crosslinking agent in the production of polymer networks. Due to its two central carbon atoms linked by a flexible chain, this compound can bridge different polymer chains and promote the formation of highly crosslinked structures. This crosslinking capability is particularly valuable in the creation of materials with enhanced mechanical strength, thermal stability, and chemical resistance.Furthermore, 2-Ethyl-2-(((3-oxobutanoyl)oxy)methyl)propane-1,3-diyl bis(3-oxobutanoate) can also act as a linker in the construction of dendrimers and other dendritic structures. By incorporating this compound into the dendrimer synthesis process, chemists can control the branching architecture and functionalization of the resulting dendritic molecules, leading to tailored properties and applications in areas such as drug delivery, catalysis, and nanotechnology.In summary, the strategic placement of ester functionalities in 2-Ethyl-2-(((3-oxobutanoyl)oxy)methyl)propane-1,3-diyl bis(3-oxobutanoate) makes it a valuable tool for chemical synthesis, enabling the creation of advanced materials with controlled structures and properties.