AB21690
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $12.00 | $8.00 | - + | |
10g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $25.00 | $18.00 | - + | |
100g | 98% | in stock | $96.00 | $67.00 | - + | |
500g | 98% | in stock | $478.00 | $334.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21690 |
Chemical Name: | 2-Chloro-4-methyl-3-nitropyridine |
CAS Number: | 23056-39-5 |
Molecular Formula: | C6H5ClN2O2 |
Molecular Weight: | 172.5691 |
MDL Number: | MFCD00012347 |
SMILES: | [O-][N+](=O)c1c(C)ccnc1Cl |
NSC Number: | 402977 |
Complexity: | 159 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 2 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20120615