AB21814
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $18.00 | $13.00 | - + | |
1g | 96% | in stock | $23.00 | $17.00 | - + | |
5g | 96% | in stock | $111.00 | $78.00 | - + | |
10g | 96% | in stock | $219.00 | $154.00 | - + | |
25g | 96% | in stock | $544.00 | $381.00 | - + | |
100g | 96% | in stock | $1,802.00 | $1,261.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB21814 |
Chemical Name: | 5-Fluoroindole-3-carboxylic acid |
CAS Number: | 23077-43-2 |
Molecular Formula: | C9H6FNO2 |
Molecular Weight: | 179.1478 |
MDL Number: | MFCD00047171 |
SMILES: | Fc1ccc2c(c1)c(c[nH]2)C(=O)O |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.1 |
5-Fluoro-1H-indole-3-carboxylic acid is a versatile chemical compound that finds significant utility in chemical synthesis processes. Primarily, this compound serves as a crucial building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Due to its unique structure and reactivity, 5-Fluoro-1H-indole-3-carboxylic acid can participate in a wide range of organic reactions, enabling the formation of complex molecular structures with specific functionalities.In pharmaceutical synthesis, this compound can be used as a key intermediate for the preparation of bioactive molecules such as potential drug candidates or precursors to active pharmaceutical ingredients. Its presence in the molecular structure imparts desirable pharmacological properties, ranging from improved drug efficacy to enhanced bioavailability.Furthermore, in agrochemical synthesis, 5-Fluoro-1H-indole-3-carboxylic acid can be utilized to develop novel pesticides, herbicides, or fungicides with tailored properties for agricultural applications. Its incorporation into the chemical structure of these agrochemicals can lead to improved pest control efficiency and environmental safety.Overall, the application of 5-Fluoro-1H-indole-3-carboxylic acid in chemical synthesis plays a pivotal role in the creation of diverse compounds with specific functions and applications in the fields of pharmaceuticals, agrochemicals, and beyond.