AB23047
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $45.00 | $31.00 | - + | |
25g | 97% | in stock | $145.00 | $101.00 | - + | |
100g | 97% | in stock | $470.00 | $329.00 | - + | |
1kg | 97% | in stock | $4,659.00 | $3,261.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB23047 |
Chemical Name: | Bz-osu |
CAS Number: | 23405-15-4 |
Molecular Formula: | C11H9NO4 |
Molecular Weight: | 219.1935 |
MDL Number: | MFCD00078953 |
SMILES: | O=C(c1ccccc1)ON1C(=O)CCC1=O |
Complexity: | 304 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.9 |
Bioorganic & medicinal chemistry letters 20101101
Journal of chromatography. A 20031222