AB77990
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $58.00 | $40.00 | - + | |
25g | 95% | in stock | $211.00 | $148.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB77990 |
Chemical Name: | Oralith brilliant pink r |
CAS Number: | 2379-74-0 |
Molecular Formula: | C18H10Cl2O2S2 |
Molecular Weight: | 393.3068 |
MDL Number: | MFCD00059165 |
SMILES: | Clc1cc2S/C(=C3/Sc4c(C3=O)c(C)cc(c4)Cl)/C(=O)c2c(c1)C |
Complexity: | 568 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 6.1 |
Contact dermatitis 20101001
Journal of medicinal chemistry 20020411