logo
Home  > Material Science  > Material Building Blocks  > Supramolecular Host Materials   > 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane

AB46346

23978-09-8 | 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $12.00 $8.00 -   +
250mg 98% in stock $28.00 $19.00 -   +
1g 98% in stock $49.00 $34.00 -   +
5g 98% in stock $233.00 $163.00 -   +
10g 98% in stock $462.00 $323.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB46346
Chemical Name: 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane
CAS Number: 23978-09-8
Molecular Formula: C18H36N2O6
Molecular Weight: 376.4882
MDL Number: MFCD00005111
SMILES: C1COCCN2CCOCCOCCN(CCO1)CCOCCOCC2
NSC Number: 264495

 

Computed Properties
Complexity: 247  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 26  
Hydrogen Bond Acceptor Count: 8  
XLogP3: -1  

 

 

Upstream Synthesis Route 
  • 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane, commonly known as $name$, is a versatile compound used extensively in chemical synthesis. Its unique molecular structure makes it an essential component in organic chemistry processes, particularly in the formation of complex molecules and polymers. In chemical synthesis, $name$ serves as a highly efficient catalyst for various reactions due to its rigid and well-defined framework. Its ability to facilitate transformations such as ring-closing reactions, oxidation processes, and polymerization makes it a valuable tool for chemists working in diverse fields. Additionally, $name$ can act as a chelating agent, coordinating with metal ions to enhance catalytic activity in certain reactions.Furthermore, $name$ plays a crucial role in the development of novel materials and pharmaceuticals. Its controlled reactivity and selectivity enable chemists to design and construct specific molecular architectures with high precision. Whether used in the synthesis of biologically active compounds or advanced materials, $name$ offers a reliable and efficient solution for chemical researchers seeking to expand the frontiers of molecular science.
Literature
FEATURED PRODUCTS