AB44283
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $14.00 | $10.00 | - + | |
25g | 95% | in stock | $16.00 | $11.00 | - + | |
100g | 95% | in stock | $45.00 | $31.00 | - + | |
500g | 95% | in stock | $216.00 | $151.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44283 |
Chemical Name: | 3,3',4,4'-Biphenyltetracarboxylic dianhydride |
CAS Number: | 2420-87-3 |
Molecular Formula: | C16H6O6 |
Molecular Weight: | 294.2152 |
MDL Number: | MFCD00039140 |
SMILES: | O=C1OC(=O)c2c1cc(cc2)c1ccc2c(c1)C(=O)OC2=O |
Complexity: | 517 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
In chemical synthesis, 3,3,4,4-Biphenyltetracarboxylic Dianhydride plays a crucial role as a versatile building block. With its unique structure containing four carboxylic acid anhydride groups, this compound is widely utilized as a key intermediate in the production of various advanced polymers and high-performance materials. One primary application of 3,3,4,4-Biphenyltetracarboxylic Dianhydride is in the synthesis of polyimides, a class of thermally stable and mechanically robust polymers. By reacting with diamine compounds, this dianhydride can undergo polycondensation reactions to form polyimide chains, offering exceptional thermal, chemical, and electrical properties. These polyimides find use in aerospace, electronics, and other high-tech industries due to their heat resistance and dimensional stability.Furthermore, 3,3,4,4-Biphenyltetracarboxylic Dianhydride is employed in the preparation of liquid crystalline polymers (LCPs), which exhibit ordered molecular structures and unique flow properties. These LCPs are used in various applications such as in the manufacture of specialty fibers, films, and composites, where their molecular alignment provides superior mechanical strength and thermal stability.Additionally, this compound can be utilized in the synthesis of other advanced materials like conducting polymers, functionalized nanoparticles, and organic semiconductors, showcasing its significance in enabling the development of innovative technologies across different fields of materials science and engineering.
Photochemistry and photobiology 20120101