AB24638
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 90% | in stock | $16.00 | $11.00 | - + | |
5g | 90% | in stock | $19.00 | $13.00 | - + | |
25g | 90% | in stock | $34.00 | $24.00 | - + | |
100g | 90% | in stock | $90.00 | $63.00 | - + | |
500g | 90% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB24638 |
Chemical Name: | Dibenzyl azodicarboxylate |
CAS Number: | 2449-05-0 |
Molecular Formula: | C16H14N2O4 |
Molecular Weight: | 298.2934 |
MDL Number: | MFCD00016737 |
SMILES: | O=C(N=NC(=O)OCc1ccccc1)OCc1ccccc1 |
NSC Number: | 620564 |
Complexity: | 350 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.9 |
Dibenzyl diazene-1,2-dicarboxylate, also known as DNP-DC, is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block in organic chemistry, particularly in the field of organic synthesis. DNP-DC is commonly employed as a masked source of azodicarboxylate, a functional group that plays a crucial role in a variety of transformations. One of the key applications of Dibenzyl diazene-1,2-dicarboxylate is in the preparation of azo compounds through diazo transfer reactions. By utilizing DNP-DC as a precursor, chemists can access azo compounds with high selectivity and efficiency. Additionally, DNP-DC can participate in diverse chemical reactions to introduce azo functionality into target molecules, enabling the synthesis of complex organic compounds with azo moieties. This compound's versatility and reactivity make it a valuable tool for synthetic chemists seeking to access novel azo-containing compounds and molecular architectures.