AB24818
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $196.00 | $137.00 | - + | |
1g | 95% | in stock | $1,502.00 | $1,051.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB24818 |
Chemical Name: | 2-((Decyloxy)carbonyl)benzoic acid |
CAS Number: | 24539-60-4 |
Molecular Formula: | C18H26O4 |
Molecular Weight: | 306.3966 |
MDL Number: | MFCD00401823 |
SMILES: | CCCCCCCCCCOC(=O)c1ccccc1C(=O)O |
Complexity: | 327 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 12 |
XLogP3: | 6.4 |
Environmental toxicology and chemistry 20031201