AB24931
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $96.00 | $67.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB24931 |
Chemical Name: | Indole-3-acetyl-l-aspartic acid |
CAS Number: | 2456-73-7 |
Molecular Formula: | C14H14N2O5 |
Molecular Weight: | 290.2714 |
MDL Number: | MFCD00079391 |
SMILES: | O=C(Cc1c[nH]c2c1cccc2)N[C@H](C(=O)O)CC(=O)O |
Complexity: | 426 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.3 |
The compound (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block and intermediate. Its unique structure and functional groups make it an ideal candidate for various synthetic routes and reactions in organic chemistry.In chemical synthesis, $name$ can be utilized as a key starting material for the synthesis of complex organic molecules, peptides, and pharmaceuticals. The indole ring in the structure provides aromaticity and reactivity, while the butanedioic acid moiety offers flexibility and opportunities for site-specific modifications.One of the notable applications of (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid is in the formation of peptide bonds and peptide coupling reactions. Its amino acid-like structure allows for efficient coupling with other amino acids or peptide fragments, leading to the synthesis of custom peptides and peptide derivatives.Moreover, the presence of the acetyl group in the molecule can serve as a protecting group for certain functional groups during synthesis, enabling selective deprotection steps and controlled chemical transformations.Overall, the strategic incorporation of $name$ in chemical synthesis provides chemists with a powerful tool for designing and constructing complex molecules with specific functionalities and properties. Whether in peptide chemistry, drug discovery, or materials science, the versatility of (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid offers exciting possibilities for advancing synthetic methodologies and exploring new chemical space.