BJ69275
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 95% | 2 weeks | $598.00 | $419.00 | - + | |
25mg | 95% | 2 weeks | $1,015.00 | $710.00 | - + | |
100mg | 95% | 2 weeks | $1,681.00 | $1,177.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BJ69275 |
Chemical Name: | 3-Deoxy-3-chloroabiraterone (Mixture of Diastereomers) |
CAS Number: | 2484719-16-4 |
Molecular Formula: | C24H30ClN |
Molecular Weight: | 367.9547 |
SMILES: | ClC1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC=C2c2cccnc2)C)C1)C |