AI45779
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $29.00 | $20.00 | - + | |
100g | 98% | in stock | $89.00 | $62.00 | - + | |
500g | 98% | in stock | $297.00 | $208.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI45779 |
Chemical Name: | L-Methionine methyl ester, HCl |
CAS Number: | 2491-18-1 |
Molecular Formula: | C11H15N3O4 |
Molecular Weight: | 253.2545 |
MDL Number: | MFCD00012491 |
SMILES: | COc1cnc(c(c1/C=C/N(C)C)[N+](=O)[O-])OC |
Complexity: | 108 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
European journal of medicinal chemistry 20120401
Nature chemical biology 20090101