AB27240
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $314.00 | $220.00 | - + | |
1g | 98% | in stock | $1,415.00 | $991.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB27240 |
Chemical Name: | 6-Bromoquinoline-2,4-dicarboxylic acid |
CAS Number: | 250641-14-6 |
Molecular Formula: | C11H6BrNO4 |
Molecular Weight: | 296.0736 |
MDL Number: | MFCD00487568 |
SMILES: | Brc1ccc2c(c1)c(cc(n2)C(=O)O)C(=O)O |
Complexity: | 335 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
Journal of medicinal chemistry 20020523