AV18554
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV18554 |
Chemical Name: | 6-(Benzyloxy)quinoline-2,4-dicarboxylic acid |
CAS Number: | 250641-16-8 |
Molecular Formula: | C18H13NO5 |
Molecular Weight: | 323.2995 |
MDL Number: | MFCD30185857 |
SMILES: | OC(=O)c1cc(nc2c1cc(OCc1ccccc1)cc2)C(=O)O |
Complexity: | 462 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 3 |
Journal of medicinal chemistry 20020523