AB27548
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $12.00 | $8.00 | - + | |
1g | 95% | in stock | $38.00 | $26.00 | - + | |
5g | 95% | in stock | $91.00 | $64.00 | - + | |
100g | 95% | in stock | $1,504.00 | $1,053.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB27548 |
Chemical Name: | 2,3-Dioxoindoline-7-carboxylic acid |
CAS Number: | 25128-35-2 |
Molecular Formula: | C9H5NO4 |
Molecular Weight: | 191.1403 |
MDL Number: | MFCD00612492 |
SMILES: | OC(=O)c1cccc2c1NC(=O)C2=O |
Complexity: | 312 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.2 |
Journal of medicinal chemistry 20070419