AF30124
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $29.00 | $20.00 | - + | |
1g | 97% | in stock | $34.00 | $24.00 | - + | |
5g | 97% | in stock | $143.00 | $101.00 | - + | |
25g | 97% | in stock | $689.00 | $482.00 | - + | |
100g | 97% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF30124 |
Chemical Name: | 4-(Phenylethynyl)benzoic acid |
CAS Number: | 25739-23-5 |
Molecular Formula: | C15H10O2 |
Molecular Weight: | 222.2387 |
MDL Number: | MFCD00438677 |
SMILES: | OC(=O)c1ccc(cc1)C#Cc1ccccc1 |
Complexity: | 319 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.5 |
Bioorganic & medicinal chemistry letters 20101101
The FEBS journal 20100101