AD21301
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $23.00 | $16.00 | - + | |
5g | 97% | in stock | $33.00 | $23.00 | - + | |
10g | 97% | in stock | $48.00 | $33.00 | - + | |
25g | 97% | in stock | $81.00 | $57.00 | - + | |
100g | 97% | in stock | $265.00 | $186.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD21301 |
Chemical Name: | H-D-Cys(trt)-OH |
CAS Number: | 25840-82-8 |
Molecular Formula: | C22H21NO2S |
Molecular Weight: | 363.4726 |
MDL Number: | MFCD00236948 |
SMILES: | N[C@@H](C(=O)O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
Complexity: | 392 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 2 |
European journal of medicinal chemistry 20120301
Journal of medicinal chemistry 20110324