AB29525
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $21.00 | $15.00 | - + | |
5g | 97% | in stock | $41.00 | $29.00 | - + | |
25g | 97% | in stock | $153.00 | $107.00 | - + | |
100g | 97% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB29525 |
Chemical Name: | 3-Nitrobenzylamine, HCl |
CAS Number: | 26177-43-5 |
Molecular Formula: | C7H9ClN2O2 |
Molecular Weight: | 188.6116 |
MDL Number: | MFCD00012858 |
SMILES: | NCc1cccc(c1)[N+](=O)[O-].Cl |
NSC Number: | 160936 |
Complexity: | 144 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
Journal of medicinal chemistry 19840901