AB29525
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2g | 97% | in stock | $23.00 | $16.00 | - + | |
5g | 97% | in stock | $38.00 | $27.00 | - + | |
10g | 97% | in stock | $65.00 | $45.00 | - + | |
15g | 97% | in stock | $96.00 | $67.00 | - + | |
25g | 97% | in stock | $129.00 | $90.00 | - + | |
100g | 98% | in stock | $511.00 | $358.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB29525 |
Chemical Name: | 3-Nitrobenzylamine, HCl |
CAS Number: | 26177-43-5 |
Molecular Formula: | C7H9ClN2O2 |
Molecular Weight: | 188.6116 |
MDL Number: | MFCD00012858 |
SMILES: | NCc1cccc(c1)[N+](=O)[O-].Cl |
NSC Number: | 160936 |
Complexity: | 144 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
Journal of medicinal chemistry 19840901