AB31656
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $9.00 | $6.00 | - + | |
1g | 97% | in stock | $15.00 | $10.00 | - + | |
5g | 97% | in stock | $20.00 | $14.00 | - + | |
10g | 97% | in stock | $36.00 | $25.00 | - + | |
25g | 97% | in stock | $66.00 | $46.00 | - + | |
100g | 97% | in stock | $241.00 | $169.00 | - + | |
500g | 97% | in stock | $976.00 | $683.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB31656 |
Chemical Name: | 4'-Hydroxychalcone |
CAS Number: | 2657-25-2 |
Molecular Formula: | C15H12O2 |
Molecular Weight: | 224.2546 |
MDL Number: | MFCD00016484 |
SMILES: | Oc1ccc(cc1)C(=O)C=Cc1ccccc1 |
Complexity: | 269 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.7 |
Toxicological sciences : an official journal of the Society of Toxicology 20150201
Chemical research in toxicology 20121119
Biochimica et biophysica acta 20120201
Biochemical pharmacology 20110915
Bioorganic & medicinal chemistry letters 20080101
Journal of molecular graphics & modelling 20061101
Journal of medicinal chemistry 20050908
Bioorganic & medicinal chemistry letters 20020902
Journal of medicinal chemistry 20011206
Journal of medicinal chemistry 20010927