AB73856
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $34.00 | $24.00 | - + | |
5g | 96% | in stock | $95.00 | $67.00 | - + | |
10g | 96% | in stock | $179.00 | $125.00 | - + | |
25g | 96% | in stock | $420.00 | $294.00 | - + | |
100g | 96% | in stock | $1,490.00 | $1,043.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73856 |
Chemical Name: | Ethyl 4-hydroxy-6-(trifluoromethyl)quinoline-3-carboxylate |
CAS Number: | 26893-12-9 |
Molecular Formula: | C13H10F3NO3 |
Molecular Weight: | 285.2186 |
MDL Number: | MFCD00173369 |
SMILES: | CCOC(=O)c1cnc2c(c1O)cc(cc2)C(F)(F)F |
Complexity: | 445 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.9 |
Journal of medicinal chemistry 20060420