AB64607
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $6.00 | $4.00 | - + | |
1g | 98% | in stock | $8.00 | $6.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $12.00 | $9.00 | - + | |
100g | 98% | in stock | $94.00 | $66.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB64607 |
Chemical Name: | 3-Carboxyphenylboronic acid, pinacol ester |
CAS Number: | 269409-73-6 |
Molecular Formula: | C13H17BO4 |
Molecular Weight: | 248.0827 |
MDL Number: | MFCD03411930 |
SMILES: | OC(=O)c1cccc(c1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 324 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Journal of medicinal chemistry 20091008