AF44273
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $137.00 | $96.00 | - + | |
1g | 95% | in stock | $330.00 | $231.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF44273 |
Chemical Name: | 1-(4-Chlorobenzyl)-1h-indole-2,3-dione |
CAS Number: | 26960-66-7 |
Molecular Formula: | C15H10ClNO2 |
Molecular Weight: | 271.6984 |
MDL Number: | MFCD00030254 |
SMILES: | Clc1ccc(cc1)CN1c2ccccc2C(=O)C1=O |
NSC Number: | 127077 |
Complexity: | 376 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.7 |
Journal of medicinal chemistry 20070419