AF28671
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
10g | 97% | in stock | $15.00 | $11.00 | - + | |
25g | 97% | in stock | $26.00 | $18.00 | - + | |
100g | 97% | in stock | $58.00 | $40.00 | - + | |
500g | 97% | in stock | $242.00 | $169.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF28671 |
Chemical Name: | 6'-Methoxy-2'-propiononaphthone |
CAS Number: | 2700-47-2 |
Molecular Formula: | C14H14O2 |
Molecular Weight: | 214.2598 |
MDL Number: | MFCD00021645 |
SMILES: | CCC(=O)c1ccc2c(c1)ccc(c2)OC |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.3 |
Bioorganic & medicinal chemistry letters 20101101
The protein journal 20040701